ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
| Nama produk |
4-Fluoro-3-formylbenzeneboronic acid |
| Sinonim |
5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
| MF |
C7H6BFO3 |
| Berat Molekul |
167.9301 |
| InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
| CAS NO |
374538-01-9 |
| Struktur Molekul |
|
| Kepadatan |
1.33g/cm3 |
| Titik didih |
342.9°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
161.2°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
