ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
Nama produk |
4-Fluoro-3-formylbenzeneboronic acid |
Sinonim |
5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
MF |
C7H6BFO3 |
Berat Molekul |
167.9301 |
InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
CAS NO |
374538-01-9 |
Struktur Molekul |
|
Kepadatan |
1.33g/cm3 |
Titik didih |
342.9°C at 760 mmHg |
Indeks bias |
1.524 |
Titik nyala |
161.2°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|